C17H14F6N4 — CID 52941058
4-[3-(2,2,2-trifluoroethylamino)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile (PubChem CID 52941058) has the molecular formula C17H14F6N4 and a molecular weight of 388.32 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethylamino)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile.
| Compound Name | 4-[3-(2,2,2-trifluoroethylamino)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 52941058 |
| Molecular Formula | C17H14F6N4 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethylamino)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(CCCNCC(F)(F)F)cc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H14F6N4/c18-16(19,20)10-25-6-2-5-13-8-14(27-15(9-24)26-13)11-3-1-4-12(7-11)17(21,22)23/h1,3-4,7-8,25H,2,5-6,10H2 |
| InChIKey | ZJFWVNHALIHVNI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|