C15H25N3O — CID 52941176
(1R,2R,4S,9S,17S)-4-amino-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (PubChem CID 52941176) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (1R,2R,4S,9S,17S)-4-amino-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one.
| Compound Name | (1R,2R,4S,9S,17S)-4-amino-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
|---|---|
| PubChem CID | 52941176 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (1R,2R,4S,9S,17S)-4-amino-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES | N[C@@H]1CC(=O)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@H]2C1 |
| InChI | InChI=1S/C15H25N3O/c16-11-7-13-12-4-2-6-17-5-1-3-10(15(12)17)9-18(13)14(19)8-11/h10-13,15H,1-9,16H2/t10-,11-,12+,13+,15-/m0/s1 |
| InChIKey | IJFXDTNYLMMUGZ-WHPHWUKISA-N |
| XLogP | 0.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |