C25H36ClN3O2 — CID 52941289
[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride (PubChem CID 52941289) has the molecular formula C25H36ClN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is [(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride.
| Compound Name | [(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 52941289 |
| Molecular Formula | C25H36ClN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride |
| SMILES | COc1cccc2c(C(=O)N3C[C@@H]4CCCN4C[C@H]3C)cn(CC3CCCCC3)c12.Cl |
| InChI | InChI=1S/C25H35N3O2.ClH/c1-18-14-26-13-7-10-20(26)16-28(18)25(29)22-17-27(15-19-8-4-3-5-9-19)24-21(22)11-6-12-23(24)30-2;/h6,11-12,17-20H,3-5,7-10,13-16H2,1-2H3;1H/t18-,20+;/m1./s1 |
| InChIKey | QNRFAYBLRUYEFW-VDWUQFQWSA-N |
| XLogP | 4.96 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |