C28H41N3O2 — CID 52941294
[(3R,8aR)-3-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone (PubChem CID 52941294) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is [(3R,8aR)-3-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone.
| Compound Name | [(3R,8aR)-3-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone |
|---|---|
| PubChem CID | 52941294 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | [(3R,8aR)-3-(2-methylpropyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone |
| SMILES | COc1cccc2c(C(=O)N3C[C@H]4CCCN4C[C@H]3CC(C)C)cn(CC3CCCCC3)c12 |
| InChI | InChI=1S/C28H41N3O2/c1-20(2)15-23-17-29-14-8-11-22(29)18-31(23)28(32)25-19-30(16-21-9-5-4-6-10-21)27-24(25)12-7-13-26(27)33-3/h7,12-13,19-23H,4-6,8-11,14-18H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | LBRLKEYZOKDWQC-DHIUTWEWSA-N |
| XLogP | 5.57 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |