C20H19N5OS — CID 52941315
4-[[(3S)-piperidin-3-yl]amino]-2-(2-pyridin-3-ylethynyl)thieno[3,2-c]pyridine-7-carboxamide (PubChem CID 52941315) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[[(3S)-piperidin-3-yl]amino]-2-(2-pyridin-3-ylethynyl)thieno[3,2-c]pyridine-7-carboxamide.
| Compound Name | 4-[[(3S)-piperidin-3-yl]amino]-2-(2-pyridin-3-ylethynyl)thieno[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 52941315 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-[[(3S)-piperidin-3-yl]amino]-2-(2-pyridin-3-ylethynyl)thieno[3,2-c]pyridine-7-carboxamide |
| SMILES | NC(=O)c1cnc(N[C@H]2CCCNC2)c2cc(C#Cc3cccnc3)sc12 |
| InChI | InChI=1S/C20H19N5OS/c21-19(26)17-12-24-20(25-14-4-2-8-23-11-14)16-9-15(27-18(16)17)6-5-13-3-1-7-22-10-13/h1,3,7,9-10,12,14,23H,2,4,8,11H2,(H2,21,26)(H,24,25)/t14-/m0/s1 |
| InChIKey | BAVMROPUIMWJCX-AWEZNQCLSA-N |
| XLogP | 2.35 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|