C19H22N4O6S — CID 5294133
N-(2-cyanoethyl)-N-[[5-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]methanesulfonamide (PubChem CID 5294133) has the molecular formula C19H22N4O6S and a molecular weight of 434.47 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-[[5-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]methanesulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-[[5-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 5294133 |
| Molecular Formula | C19H22N4O6S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-(2-cyanoethyl)-N-[[5-[(Z)-(1-cyclopentyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCC#N)Cc1ccc(/C=C2/C(=O)NC(=O)N(C3CCCC3)C2=O)o1 |
| InChI | InChI=1S/C19H22N4O6S/c1-30(27,28)22(10-4-9-20)12-15-8-7-14(29-15)11-16-17(24)21-19(26)23(18(16)25)13-5-2-3-6-13/h7-8,11,13H,2-6,10,12H2,1H3,(H,21,24,26)/b16-11- |
| InChIKey | HUFQRNYOZKCNCH-WJDWOHSUSA-N |
| XLogP | 1.36 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|