C21H35IN2O2SeSi — CID 52941365
(4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyclohexylimino-4-(iodomethylidene)-3-selena-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 52941365) has the molecular formula C21H35IN2O2SeSi and a molecular weight of 581.47 g/mol. Its IUPAC name is (4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyclohexylimino-4-(iodomethylidene)-3-selena-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyclohexylimino-4-(iodomethylidene)-3-selena-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 52941365 |
| Molecular Formula | C21H35IN2O2SeSi |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | (4E,6R,7S)-7-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyclohexylimino-4-(iodomethylidene)-3-selena-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2/C(=N/C3CCCCC3)[Se]/C(=C/I)C[C@H]12 |
| InChI | InChI=1S/C21H35IN2O2SeSi/c1-14(26-28(5,6)21(2,3)4)18-17-12-16(13-22)27-20(24(17)19(18)25)23-15-10-8-7-9-11-15/h13-15,17-18H,7-12H2,1-6H3/b16-13+,23-20-/t14-,17-,18-/m1/s1 |
| InChIKey | IOBNVXALKLIYTN-KQTARZCWSA-N |
| XLogP | 5.30 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|