About 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine
2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine (PubChem CID 52941378) has the molecular formula C16H14Cl2N4
and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine.
Molecular Properties
| Compound Name | 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine |
| PubChem CID | 52941378 |
| Molecular Formula | C16H14Cl2N4 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(/C=C/c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N4/c17-13-8-7-12(10-14(13)18)15(21-22-16(19)20)9-6-11-4-2-1-3-5-11/h1-10H,(H4,19,20,22)/b9-6+,21-15- |
| InChIKey | FEWDOXXBINEXKB-OQTFOHMESA-N |
| XLogP | 3.68 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine?
The IUPAC name of 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine (CID 52941378) is 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine.
What is the SMILES notation for 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine?
The canonical SMILES for 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine is NC(N)=N/N=C(/C=C/c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine?
The InChIKey is FEWDOXXBINEXKB-OQTFOHMESA-N. The full InChI is InChI=1S/C16H14Cl2N4/c17-13-8-7-12(10-14(13)18)15(21-22-16(19)20)9-6-11-4-2-1-3-5-11/h1-10H,(H4,19,20,22)/b9-6+,21-15-.
What are the key properties of 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine?
2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine has a molecular weight of 333.22 g/mol, XLogP of 3.68, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-[(E)-1-(3,4-dichlorophenyl)-3-phenylprop-2-enylidene]amino]guanidine is sourced from PubChem (CID 52941378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).