C20H18F9N3O2S — CID 52941433
1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-phenyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 52941433) has the molecular formula C20H18F9N3O2S and a molecular weight of 535.43 g/mol. Its IUPAC name is 1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-phenyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-phenyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 52941433 |
| Molecular Formula | C20H18F9N3O2S |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-phenyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(c2ccccc2)CCN(c2ncc(C(O)(C(F)(F)F)C(F)(F)F)s2)CC1 |
| InChI | InChI=1S/C20H18F9N3O2S/c21-17(22,23)11-31-14(33)16(12-4-2-1-3-5-12)6-8-32(9-7-16)15-30-10-13(35-15)18(34,19(24,25)26)20(27,28)29/h1-5,10,34H,6-9,11H2,(H,31,33) |
| InChIKey | WNHDZTYQHQPEDC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |