About 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide
2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 52941466) has the molecular formula C15H12ClF3N4O3
and a molecular weight of 388.73 g/mol. Its IUPAC name is 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide |
| PubChem CID | 52941466 |
| Molecular Formula | C15H12ClF3N4O3 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(C(F)(F)F)c1Cl)C(=O)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C15H12ClF3N4O3/c1-7(12(24)14(26)22-10-5-6-20-23-10)21-13(25)8-3-2-4-9(11(8)16)15(17,18)19/h2-7H,1H3,(H,21,25)(H2,20,22,23,26) |
| InChIKey | IGBRTMNMZLDZHD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide?
The IUPAC name of 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide (CID 52941466) is 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide.
What is the SMILES notation for 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide?
The canonical SMILES for 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide is CC(NC(=O)c1cccc(C(F)(F)F)c1Cl)C(=O)C(=O)Nc1ccn[nH]1.
What is the InChIKey of 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide?
The InChIKey is IGBRTMNMZLDZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF3N4O3/c1-7(12(24)14(26)22-10-5-6-20-23-10)21-13(25)8-3-2-4-9(11(8)16)15(17,18)19/h2-7H,1H3,(H,21,25)(H2,20,22,23,26).
What are the key properties of 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide?
2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide has a molecular weight of 388.73 g/mol, XLogP of 2.41, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3,4-dioxo-4-(1H-pyrazol-5-ylamino)butan-2-yl]-3-(trifluoromethyl)benzamide is sourced from PubChem (CID 52941466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).