C23H22F6N6 — CID 52941523
2-N,2-N-dimethyl-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 52941523) has the molecular formula C23H22F6N6 and a molecular weight of 496.46 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 52941523 |
| Molecular Formula | C23H22F6N6 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CN(C)c1nc2c(c(Nc3ccc(C(F)(F)F)cc3)n1)CCN(c1ncccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C23H22F6N6/c1-34(2)21-32-18-10-13-35(20-17(23(27,28)29)4-3-11-30-20)12-9-16(18)19(33-21)31-15-7-5-14(6-8-15)22(24,25)26/h3-8,11H,9-10,12-13H2,1-2H3,(H,31,32,33) |
| InChIKey | LJHINLLUZGVENH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |