C24H20F3N3O — CID 52941615
1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one (PubChem CID 52941615) has the molecular formula C24H20F3N3O and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one.
| Compound Name | 1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 52941615 |
| Molecular Formula | C24H20F3N3O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)-4-[4-(trifluoromethyl)phenyl]pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)cc5)cc4=O)cc31)CCNC2 |
| InChI | InChI=1S/C24H20F3N3O/c1-29-21-13-18(6-7-19(21)20-8-10-28-14-22(20)29)30-11-9-16(12-23(30)31)15-2-4-17(5-3-15)24(25,26)27/h2-7,9,11-13,28H,8,10,14H2,1H3 |
| InChIKey | ASAAKNKHYPJQGZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|