C33H39Cl3N4O5 — CID 52941636
(3R,4S)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxamide (PubChem CID 52941636) has the molecular formula C33H39Cl3N4O5 and a molecular weight of 678.06 g/mol. Its IUPAC name is (3R,4S)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 52941636 |
| Molecular Formula | C33H39Cl3N4O5 |
| Molecular Weight | 678.06 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | (3R,4S)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxamide |
| SMILES | COCCCc1cc(CN(C(=O)[C@H]2CNCC[C@@H]2c2ccc(OCCOc3c(Cl)cc(C)cc3Cl)nc2)C2CC2)c(Cl)c[n+]1[O-] |
| InChI | InChI=1S/C33H39Cl3N4O5/c1-21-14-28(34)32(29(35)15-21)45-13-12-44-31-8-5-22(17-38-31)26-9-10-37-18-27(26)33(41)39(24-6-7-24)19-23-16-25(4-3-11-43-2)40(42)20-30(23)36/h5,8,14-17,20,24,26-27,37H,3-4,6-7,9-13,18-19H2,1-2H3/t26-,27+/m1/s1 |
| InChIKey | QFAZSNXTORHKQD-SXOMAYOGSA-N |
| XLogP | 5.90 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.06 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|