C21H54O5Si5 — CID 529419
trimethyl-[1,3,4,5-tetrakis(trimethylsilyloxy)hexan-2-yloxy]silane (PubChem CID 529419) has the molecular formula C21H54O5Si5 and a molecular weight of 527.09 g/mol. Its IUPAC name is trimethyl-[1,3,4,5-tetrakis(trimethylsilyloxy)hexan-2-yloxy]silane.
| Compound Name | trimethyl-[1,3,4,5-tetrakis(trimethylsilyloxy)hexan-2-yloxy]silane |
|---|---|
| PubChem CID | 529419 |
| Molecular Formula | C21H54O5Si5 |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | trimethyl-[1,3,4,5-tetrakis(trimethylsilyloxy)hexan-2-yloxy]silane |
| SMILES | CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C21H54O5Si5/c1-18(23-28(5,6)7)20(25-30(11,12)13)21(26-31(14,15)16)19(24-29(8,9)10)17-22-27(2,3)4/h18-21H,17H2,1-16H3 |
| InChIKey | YCLDNNFGQOEZPF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|