C20H22FNO2 — CID 52941919
(2S,4S)-2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-fluoropiperidine (PubChem CID 52941919) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is (2S,4S)-2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-fluoropiperidine.
| Compound Name | (2S,4S)-2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-fluoropiperidine |
|---|---|
| PubChem CID | 52941919 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S,4S)-2-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-fluoropiperidine |
| SMILES | F[C@H]1CCN[C@H]([C@H]2COC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C20H22FNO2/c21-17-11-12-22-18(13-17)19-14-23-20(24-19,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19,22H,11-14H2/t17-,18-,19+/m0/s1 |
| InChIKey | OLGOYYOHTNZCEO-GBESFXJTSA-N |
| XLogP | 3.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |