C28H48O7 — CID 52941941
(4R,7R,8S,11S,12S)-4,7,8-trihydroxy-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-oxacyclododecan-2-one (PubChem CID 52941941) has the molecular formula C28H48O7 and a molecular weight of 496.69 g/mol. Its IUPAC name is (4R,7R,8S,11S,12S)-4,7,8-trihydroxy-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-oxacyclododecan-2-one.
| Compound Name | (4R,7R,8S,11S,12S)-4,7,8-trihydroxy-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-oxacyclododecan-2-one |
|---|---|
| PubChem CID | 52941941 |
| Molecular Formula | C28H48O7 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (4R,7R,8S,11S,12S)-4,7,8-trihydroxy-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-oxacyclododecan-2-one |
| SMILES | CC[C@H](O)C(C)[C@H]1O[C@@H]1C[C@H](C)/C=C/C=C(\C)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](O)CC[C@@H]1C |
| InChI | InChI=1S/C28H48O7/c1-7-22(30)20(5)27-23(34-27)15-17(2)9-8-10-18(3)26-19(4)11-12-24(31)28(6,33)14-13-21(29)16-25(32)35-26/h8-10,17,19-24,26-27,29-31,33H,7,11-16H2,1-6H3/b9-8+,18-10+/t17-,19+,20?,21-,22+,23-,24+,26-,27-,28-/m1/s1 |
| InChIKey | BKRRCBIYORMPBI-JWTBQIQPSA-N |
| XLogP | 3.67 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|