C17H29NO — CID 52941964
(2E,6E,10R,11R)-10-(dimethylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one (PubChem CID 52941964) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is (2E,6E,10R,11R)-10-(dimethylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one.
| Compound Name | (2E,6E,10R,11R)-10-(dimethylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 52941964 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (2E,6E,10R,11R)-10-(dimethylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(=O)[C@H](C)[C@H](N(C)C)CC1 |
| InChI | InChI=1S/C17H29NO/c1-13-7-8-15(18(5)6)14(2)16(19)10-12-17(3,4)11-9-13/h9-10,12,14-15H,7-8,11H2,1-6H3/b12-10+,13-9+/t14-,15-/m1/s1 |
| InChIKey | FEZLUHCBKQLEIP-HLAZLLISSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|