About N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide
N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide (PubChem CID 52942057) has the molecular formula C17H16N4
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide |
| PubChem CID | 52942057 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide |
| SMILES | C/N=C/Nc1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H16N4/c1-18-13-19-17-12-16(14-8-4-2-5-9-14)20-21(17)15-10-6-3-7-11-15/h2-13H,1H3,(H,18,19) |
| InChIKey | KNYPOPRYOUDBCJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide?
The IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide (CID 52942057) is N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide.
What is the SMILES notation for N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide?
The canonical SMILES for N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide is C/N=C/Nc1cc(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide?
The InChIKey is KNYPOPRYOUDBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4/c1-18-13-19-17-12-16(14-8-4-2-5-9-14)20-21(17)15-10-6-3-7-11-15/h2-13H,1H3,(H,18,19).
What are the key properties of N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide?
N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide has a molecular weight of 276.34 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-diphenylpyrazol-5-yl)-N'-methylmethanimidamide is sourced from PubChem (CID 52942057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).