C12H26O6 — CID 529421
1,2,3,4,5,6-hexamethoxyhexane (PubChem CID 529421) has the molecular formula C12H26O6 and a molecular weight of 266.33 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethoxyhexane.
| Compound Name | 1,2,3,4,5,6-hexamethoxyhexane |
|---|---|
| PubChem CID | 529421 |
| Molecular Formula | C12H26O6 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1,2,3,4,5,6-hexamethoxyhexane |
| SMILES | COCC(OC)C(OC)C(OC)C(COC)OC |
| InChI | InChI=1S/C12H26O6/c1-13-7-9(15-3)11(17-5)12(18-6)10(16-4)8-14-2/h9-12H,7-8H2,1-6H3 |
| InChIKey | UJQZVTQJKNAPOQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |