C22H8Cl4I4O5 — CID 52942151
ethyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate (PubChem CID 52942151) has the molecular formula C22H8Cl4I4O5 and a molecular weight of 1001.73 g/mol. Its IUPAC name is ethyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate.
| Compound Name | ethyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 52942151 |
| Molecular Formula | C22H8Cl4I4O5 |
| Molecular Weight | 1001.73 g/mol |
| Exact Mass | 999.53 |
| IUPAC Name | ethyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate |
| SMILES | CCOC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1-c1c2cc(I)c(=O)c(I)c-2oc2c(I)c(O)c(I)cc12 |
| InChI | InChI=1S/C22H8Cl4I4O5/c1-2-34-22(33)11-10(12(23)14(25)15(26)13(11)24)9-5-3-7(27)18(31)16(29)20(5)35-21-6(9)4-8(28)19(32)17(21)30/h3-4,31H,2H2,1H3 |
| InChIKey | SNXLSBGTAFAUID-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.73 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|