C24H28N4O4S — CID 52942168
2-methyl-N-(2-morpholin-4-ylethyl)-5-phenyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide (PubChem CID 52942168) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-methyl-N-(2-morpholin-4-ylethyl)-5-phenyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide.
| Compound Name | 2-methyl-N-(2-morpholin-4-ylethyl)-5-phenyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52942168 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-methyl-N-(2-morpholin-4-ylethyl)-5-phenyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCOCC2)cc(-c2ccccc2)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-18-22(24(29)26-11-12-27-13-15-32-16-14-27)17-23(19-5-3-2-4-6-19)28(18)20-7-9-21(10-8-20)33(25,30)31/h2-10,17H,11-16H2,1H3,(H,26,29)(H2,25,30,31) |
| InChIKey | ABMSRNRLDZVJFV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|