C32H30F2N4O2 — CID 52942173
N-[(1R)-1-(3,5-difluorophenyl)ethyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide (PubChem CID 52942173) has the molecular formula C32H30F2N4O2 and a molecular weight of 540.61 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-difluorophenyl)ethyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide.
| Compound Name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide |
|---|---|
| PubChem CID | 52942173 |
| Molecular Formula | C32H30F2N4O2 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide |
| SMILES | C[C@H](c1cc(F)cc(F)c1)N(Cc1cnc2cc3c(cc2c1)C[C@@]1(C3)C(=O)Nc2ncccc21)C(=O)C(C)(C)C |
| InChI | InChI=1S/C32H30F2N4O2/c1-18(20-10-24(33)13-25(34)11-20)38(30(40)31(2,3)4)17-19-8-21-9-22-14-32(15-23(22)12-27(21)36-16-19)26-6-5-7-35-28(26)37-29(32)39/h5-13,16,18H,14-15,17H2,1-4H3,(H,35,37,39)/t18-,32+/m1/s1 |
| InChIKey | RGMJGGSGBPLMKC-CVCYQNGTSA-N |
| XLogP | 6.03 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |