About 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide
3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide (PubChem CID 52942251) has the molecular formula C21H21N7O
and a molecular weight of 387.45 g/mol. Its IUPAC name is 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide |
| PubChem CID | 52942251 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2nccc(N(C)c3cccc4[nH]ncc34)n2)c1 |
| InChI | InChI=1S/C21H21N7O/c1-27(2)20(29)14-6-4-7-15(12-14)24-21-22-11-10-19(25-21)28(3)18-9-5-8-17-16(18)13-23-26-17/h4-13H,1-3H3,(H,23,26)(H,22,24,25) |
| InChIKey | AXNPQTPNOPBAQE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide?
The IUPAC name of 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide (CID 52942251) is 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide?
The canonical SMILES for 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide is CN(C)C(=O)c1cccc(Nc2nccc(N(C)c3cccc4[nH]ncc34)n2)c1.
What is the InChIKey of 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide?
The InChIKey is AXNPQTPNOPBAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7O/c1-27(2)20(29)14-6-4-7-15(12-14)24-21-22-11-10-19(25-21)28(3)18-9-5-8-17-16(18)13-23-26-17/h4-13H,1-3H3,(H,23,26)(H,22,24,25).
What are the key properties of 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide?
3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide has a molecular weight of 387.45 g/mol, XLogP of 3.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[1H-indazol-4-yl(methyl)amino]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 52942251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).