C21H32ClN5 — CID 52942270
6-[[(3S,4S)-1-(2-aminoethyl)-4-(3-phenylpropylamino)pyrrolidin-3-yl]methyl]pyridin-2-amine;hydrochloride (PubChem CID 52942270) has the molecular formula C21H32ClN5 and a molecular weight of 389.98 g/mol. Its IUPAC name is 6-[[(3S,4S)-1-(2-aminoethyl)-4-(3-phenylpropylamino)pyrrolidin-3-yl]methyl]pyridin-2-amine;hydrochloride.
| Compound Name | 6-[[(3S,4S)-1-(2-aminoethyl)-4-(3-phenylpropylamino)pyrrolidin-3-yl]methyl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 52942270 |
| Molecular Formula | C21H32ClN5 |
| Molecular Weight | 389.98 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 6-[[(3S,4S)-1-(2-aminoethyl)-4-(3-phenylpropylamino)pyrrolidin-3-yl]methyl]pyridin-2-amine;hydrochloride |
| SMILES | Cl.NCCN1C[C@H](Cc2cccc(N)n2)[C@H](NCCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H31N5.ClH/c22-11-13-26-15-18(14-19-9-4-10-21(23)25-19)20(16-26)24-12-5-8-17-6-2-1-3-7-17;/h1-4,6-7,9-10,18,20,24H,5,8,11-16,22H2,(H2,23,25);1H/t18-,20+;/m0./s1 |
| InChIKey | BECPFSXWMOLYET-VKLKMBQZSA-N |
| XLogP | 2.11 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.98 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|