C26H31BrO5S — CID 52942283
(4-bromophenyl)sulfonyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 52942283) has the molecular formula C26H31BrO5S and a molecular weight of 535.50 g/mol. Its IUPAC name is (4-bromophenyl)sulfonyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | (4-bromophenyl)sulfonyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 52942283 |
| Molecular Formula | C26H31BrO5S |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | (4-bromophenyl)sulfonyl (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)OS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H31BrO5S/c1-25-13-11-18(28)15-16(25)3-8-20-21-9-10-23(26(21,2)14-12-22(20)25)24(29)32-33(30,31)19-6-4-17(27)5-7-19/h4-7,15,20-23H,3,8-14H2,1-2H3/t20-,21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | FCWPXXVMHFIPHO-PDVSWFIFSA-N |
| XLogP | 5.83 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|