C24H30N2O2 — CID 52942408
2-amino-1-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)hexan-3-one (PubChem CID 52942408) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-amino-1-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)hexan-3-one.
| Compound Name | 2-amino-1-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)hexan-3-one |
|---|---|
| PubChem CID | 52942408 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-amino-1-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)hexan-3-one |
| SMILES | CCCC(=O)C(N)CC1=CC(OC)=CN2C(=C1)C1=CC=CCC13CCCC=C23 |
| InChI | InChI=1S/C24H30N2O2/c1-3-8-22(27)20(25)14-17-13-18(28-2)16-26-21(15-17)19-9-4-6-11-24(19)12-7-5-10-23(24)26/h4,6,9-10,13,15-16,20H,3,5,7-8,11-12,14,25H2,1-2H3 |
| InChIKey | NCDDOKYQRTXQNS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |