C47H39N3O3S — CID 52942425
1-benzyl-3-[(1-benzylindol-1-ium-3-ylidene)-(1-benzylindol-3-yl)methyl]indole;methanesulfonate (PubChem CID 52942425) has the molecular formula C47H39N3O3S and a molecular weight of 725.91 g/mol. Its IUPAC name is 1-benzyl-3-[(1-benzylindol-1-ium-3-ylidene)-(1-benzylindol-3-yl)methyl]indole;methanesulfonate.
| Compound Name | 1-benzyl-3-[(1-benzylindol-1-ium-3-ylidene)-(1-benzylindol-3-yl)methyl]indole;methanesulfonate |
|---|---|
| PubChem CID | 52942425 |
| Molecular Formula | C47H39N3O3S |
| Molecular Weight | 725.91 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | 1-benzyl-3-[(1-benzylindol-1-ium-3-ylidene)-(1-benzylindol-3-yl)methyl]indole;methanesulfonate |
| SMILES | C1=[N+](Cc2ccccc2)c2ccccc2C1=C(c1cn(Cc2ccccc2)c2ccccc12)c1cn(Cc2ccccc2)c2ccccc12.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C46H36N3.CH4O3S/c1-4-16-34(17-5-1)28-47-31-40(37-22-10-13-25-43(37)47)46(41-32-48(29-35-18-6-2-7-19-35)44-26-14-11-23-38(41)44)42-33-49(30-36-20-8-3-9-21-36)45-27-15-12-24-39(42)45;1-5(2,3)4/h1-27,31-33H,28-30H2;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | OADFOZBIJWMLCT-UHFFFAOYSA-M |
| XLogP | 9.74 |
| TPSA | 70.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.91 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|