C32H33N3O3S — CID 52942542
1-ethyl-3-[(1-ethylindol-1-ium-3-ylidene)-(1-ethylindol-3-yl)methyl]indole;methanesulfonate (PubChem CID 52942542) has the molecular formula C32H33N3O3S and a molecular weight of 539.70 g/mol. Its IUPAC name is 1-ethyl-3-[(1-ethylindol-1-ium-3-ylidene)-(1-ethylindol-3-yl)methyl]indole;methanesulfonate.
| Compound Name | 1-ethyl-3-[(1-ethylindol-1-ium-3-ylidene)-(1-ethylindol-3-yl)methyl]indole;methanesulfonate |
|---|---|
| PubChem CID | 52942542 |
| Molecular Formula | C32H33N3O3S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 1-ethyl-3-[(1-ethylindol-1-ium-3-ylidene)-(1-ethylindol-3-yl)methyl]indole;methanesulfonate |
| SMILES | CCn1cc(C(=C2C=[N+](CC)c3ccccc32)c2cn(CC)c3ccccc23)c2ccccc21.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C31H30N3.CH4O3S/c1-4-32-19-25(22-13-7-10-16-28(22)32)31(26-20-33(5-2)29-17-11-8-14-23(26)29)27-21-34(6-3)30-18-12-9-15-24(27)30;1-5(2,3)4/h7-21H,4-6H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | HMEUUBYJMIBFNI-UHFFFAOYSA-M |
| XLogP | 6.50 |
| TPSA | 70.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|