About ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride
ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride (PubChem CID 52942607) has the molecular formula C14H18Cl3NO2
and a molecular weight of 338.66 g/mol. Its IUPAC name is ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride |
| PubChem CID | 52942607 |
| Molecular Formula | C14H18Cl3NO2 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(c2ccc(Cl)c(Cl)c2)CCNCC1.Cl |
| InChI | InChI=1S/C14H17Cl2NO2.ClH/c1-2-19-13(18)14(5-7-17-8-6-14)10-3-4-11(15)12(16)9-10;/h3-4,9,17H,2,5-8H2,1H3;1H |
| InChIKey | HJQBEBJKYGEVNO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride?
The IUPAC name of ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride (CID 52942607) is ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride?
The canonical SMILES for ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride is CCOC(=O)C1(c2ccc(Cl)c(Cl)c2)CCNCC1.Cl.
What is the InChIKey of ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride?
The InChIKey is HJQBEBJKYGEVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO2.ClH/c1-2-19-13(18)14(5-7-17-8-6-14)10-3-4-11(15)12(16)9-10;/h3-4,9,17H,2,5-8H2,1H3;1H.
What are the key properties of ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride?
ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride has a molecular weight of 338.66 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 52942607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).