C29H34N4O7 — CID 52942643
(2S)-N'-hydroxy-N-quinolin-8-yl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]octanediamide (PubChem CID 52942643) has the molecular formula C29H34N4O7 and a molecular weight of 550.61 g/mol. Its IUPAC name is (2S)-N'-hydroxy-N-quinolin-8-yl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]octanediamide.
| Compound Name | (2S)-N'-hydroxy-N-quinolin-8-yl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]octanediamide |
|---|---|
| PubChem CID | 52942643 |
| Molecular Formula | C29H34N4O7 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (2S)-N'-hydroxy-N-quinolin-8-yl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]octanediamide |
| SMILES | COc1cc(/C=C/C(=O)N[C@@H](CCCCCC(=O)NO)C(=O)Nc2cccc3cccnc23)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N4O7/c1-38-23-17-19(18-24(39-2)28(23)40-3)14-15-25(34)31-22(11-5-4-6-13-26(35)33-37)29(36)32-21-12-7-9-20-10-8-16-30-27(20)21/h7-10,12,14-18,22,37H,4-6,11,13H2,1-3H3,(H,31,34)(H,32,36)(H,33,35)/b15-14+/t22-/m0/s1 |
| InChIKey | UZUDWJNHODKZHC-FRFYRWIFSA-N |
| XLogP | 3.85 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|