C17H18ClN5O2S — CID 52942687
(2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]purin-9-yl]methyl]thiolane-3,4-diol (PubChem CID 52942687) has the molecular formula C17H18ClN5O2S and a molecular weight of 391.88 g/mol. Its IUPAC name is (2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]purin-9-yl]methyl]thiolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]purin-9-yl]methyl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 52942687 |
| Molecular Formula | C17H18ClN5O2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]purin-9-yl]methyl]thiolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CS[C@H]1Cn1cnc2c(NCc3cccc(Cl)c3)ncnc21 |
| InChI | InChI=1S/C17H18ClN5O2S/c18-11-3-1-2-10(4-11)5-19-16-14-17(21-8-20-16)23(9-22-14)6-13-15(25)12(24)7-26-13/h1-4,8-9,12-13,15,24-25H,5-7H2,(H,19,20,21)/t12-,13+,15-/m1/s1 |
| InChIKey | PGSCDFSNYWIMII-VNHYZAJKSA-N |
| XLogP | 1.93 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |