C14H10FNO2 — CID 52942744
3-benzyl-5-fluoro-1,3-benzoxazol-2-one (PubChem CID 52942744) has the molecular formula C14H10FNO2 and a molecular weight of 243.24 g/mol. Its IUPAC name is 3-benzyl-5-fluoro-1,3-benzoxazol-2-one.
| Compound Name | 3-benzyl-5-fluoro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 52942744 |
| Molecular Formula | C14H10FNO2 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-benzyl-5-fluoro-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccc(F)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C14H10FNO2/c15-11-6-7-13-12(8-11)16(14(17)18-13)9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | YYEOCYSVLLWJQE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |