About 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea
1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea (PubChem CID 52942898) has the molecular formula C24H26N4OS2
and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea.
Molecular Properties
| Compound Name | 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea |
| PubChem CID | 52942898 |
| Molecular Formula | C24H26N4OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea |
| SMILES | Cc1cc(NC(=O)NCCCCCCSc2nc3ccccc3s2)c2ccccc2n1 |
| InChI | InChI=1S/C24H26N4OS2/c1-17-16-21(18-10-4-5-11-19(18)26-17)27-23(29)25-14-8-2-3-9-15-30-24-28-20-12-6-7-13-22(20)31-24/h4-7,10-13,16H,2-3,8-9,14-15H2,1H3,(H2,25,26,27,29) |
| InChIKey | YJNPEHBJWXUBQM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea?
The IUPAC name of 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea (CID 52942898) is 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea.
What is the SMILES notation for 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea?
The canonical SMILES for 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea is Cc1cc(NC(=O)NCCCCCCSc2nc3ccccc3s2)c2ccccc2n1.
What is the InChIKey of 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea?
The InChIKey is YJNPEHBJWXUBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4OS2/c1-17-16-21(18-10-4-5-11-19(18)26-17)27-23(29)25-14-8-2-3-9-15-30-24-28-20-12-6-7-13-22(20)31-24/h4-7,10-13,16H,2-3,8-9,14-15H2,1H3,(H2,25,26,27,29).
What are the key properties of 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea?
1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea has a molecular weight of 450.63 g/mol, XLogP of 6.63, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(1,3-benzothiazol-2-ylsulfanyl)hexyl]-3-(2-methylquinolin-4-yl)urea is sourced from PubChem (CID 52942898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).