C37H47ClN4O3 — CID 52942903
(2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-[[(2S)-2-phenylpent-4-enoyl]amino]acetyl]amino]-4-methylpentanamide (PubChem CID 52942903) has the molecular formula C37H47ClN4O3 and a molecular weight of 631.26 g/mol. Its IUPAC name is (2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-[[(2S)-2-phenylpent-4-enoyl]amino]acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-[[(2S)-2-phenylpent-4-enoyl]amino]acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 52942903 |
| Molecular Formula | C37H47ClN4O3 |
| Molecular Weight | 631.26 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | (2S)-N-[(5-chloro-2-prop-2-enyl-1H-indol-3-yl)methyl]-2-[[(2R)-2-cyclohexyl-2-[[(2S)-2-phenylpent-4-enoyl]amino]acetyl]amino]-4-methylpentanamide |
| SMILES | C=CCc1[nH]c2ccc(Cl)cc2c1CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(=O)[C@@H](CC=C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C37H47ClN4O3/c1-5-13-28(25-15-9-7-10-16-25)35(43)42-34(26-17-11-8-12-18-26)37(45)41-33(21-24(3)4)36(44)39-23-30-29-22-27(38)19-20-32(29)40-31(30)14-6-2/h5-7,9-10,15-16,19-20,22,24,26,28,33-34,40H,1-2,8,11-14,17-18,21,23H2,3-4H3,(H,39,44)(H,41,45)(H,42,43)/t28-,33-,34+/m0/s1 |
| InChIKey | AXGLTOGRMUAICR-VEYDHLCMSA-N |
| XLogP | 7.12 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.26 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|