About decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate
decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate (PubChem CID 52942907) has the molecular formula C24H42N2O5
and a molecular weight of 438.61 g/mol. Its IUPAC name is decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate.
Molecular Properties
| Compound Name | decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate |
| PubChem CID | 52942907 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate |
| SMILES | CCCCCCCCCCOC(=O)C(CCCCN1C(=O)CCC1=O)N1CCOCC1 |
| InChI | InChI=1S/C24H42N2O5/c1-2-3-4-5-6-7-8-11-18-31-24(29)21(25-16-19-30-20-17-25)12-9-10-15-26-22(27)13-14-23(26)28/h21H,2-20H2,1H3 |
| InChIKey | CNUDMERXWQKAKP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate?
The IUPAC name of decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate (CID 52942907) is decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate.
What is the SMILES notation for decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate?
The canonical SMILES for decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate is CCCCCCCCCCOC(=O)C(CCCCN1C(=O)CCC1=O)N1CCOCC1.
What is the InChIKey of decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate?
The InChIKey is CNUDMERXWQKAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42N2O5/c1-2-3-4-5-6-7-8-11-18-31-24(29)21(25-16-19-30-20-17-25)12-9-10-15-26-22(27)13-14-23(26)28/h21H,2-20H2,1H3.
What are the key properties of decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate?
decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate has a molecular weight of 438.61 g/mol, XLogP of 3.69, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 6-(2,5-dioxopyrrolidin-1-yl)-2-morpholin-4-ylhexanoate is sourced from PubChem (CID 52942907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).