C21H28ClN5O2 — CID 52942946
2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzonitrile;hydrochloride (PubChem CID 52942946) has the molecular formula C21H28ClN5O2 and a molecular weight of 417.94 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzonitrile;hydrochloride.
| Compound Name | 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 52942946 |
| Molecular Formula | C21H28ClN5O2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccccc1N1CCN(CCCCN2C(=O)C3CCCN3C2=O)CC1 |
| InChI | InChI=1S/C21H27N5O2.ClH/c22-16-17-6-1-2-7-18(17)24-14-12-23(13-15-24)9-3-4-10-26-20(27)19-8-5-11-25(19)21(26)28;/h1-2,6-7,19H,3-5,8-15H2;1H |
| InChIKey | ZCEUZCLPVBMUSY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|