C21H21Cl2N7O2 — CID 52943028
4-N-(3,4-dichlorophenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 52943028) has the molecular formula C21H21Cl2N7O2 and a molecular weight of 474.35 g/mol. Its IUPAC name is 4-N-(3,4-dichlorophenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-(3,4-dichlorophenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 52943028 |
| Molecular Formula | C21H21Cl2N7O2 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-N-(3,4-dichlorophenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc([N+](=O)[O-])c(Nc4ccc(Cl)c(Cl)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C21H21Cl2N7O2/c1-28-8-10-29(11-9-28)16-5-2-14(3-6-16)26-21-24-13-19(30(31)32)20(27-21)25-15-4-7-17(22)18(23)12-15/h2-7,12-13H,8-11H2,1H3,(H2,24,25,26,27) |
| InChIKey | ZBBHXMABZHCPFY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|