C17H22N2O6 — CID 52943079
(2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]-N-phenylpropanamide (PubChem CID 52943079) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]-N-phenylpropanamide.
| Compound Name | (2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]-N-phenylpropanamide |
|---|---|
| PubChem CID | 52943079 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]-N-phenylpropanamide |
| SMILES | CC(=O)N[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](O)[C@H]1O[C@H](C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H22N2O6/c1-9(16(22)19-11-6-4-3-5-7-11)24-15-13(18-10(2)20)17-23-8-12(25-17)14(15)21/h3-7,9,12-15,17,21H,8H2,1-2H3,(H,18,20)(H,19,22)/t9-,12-,13-,14-,15+,17-/m1/s1 |
| InChIKey | WNJHHRIDXKHUQY-PELBVDOCSA-N |
| XLogP | 0.02 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |