C33H33NO8 — CID 52943235
3-[(3-carboxyphenyl)methyl]-1-[(6-ethyl-1,3-benzodioxol-5-yl)methyl]-4-oxo-6-pentoxyquinoline-2-carboxylic acid (PubChem CID 52943235) has the molecular formula C33H33NO8 and a molecular weight of 571.63 g/mol. Its IUPAC name is 3-[(3-carboxyphenyl)methyl]-1-[(6-ethyl-1,3-benzodioxol-5-yl)methyl]-4-oxo-6-pentoxyquinoline-2-carboxylic acid.
| Compound Name | 3-[(3-carboxyphenyl)methyl]-1-[(6-ethyl-1,3-benzodioxol-5-yl)methyl]-4-oxo-6-pentoxyquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 52943235 |
| Molecular Formula | C33H33NO8 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 3-[(3-carboxyphenyl)methyl]-1-[(6-ethyl-1,3-benzodioxol-5-yl)methyl]-4-oxo-6-pentoxyquinoline-2-carboxylic acid |
| SMILES | CCCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 |
| InChI | InChI=1S/C33H33NO8/c1-3-5-6-12-40-24-10-11-27-25(17-24)31(35)26(14-20-8-7-9-22(13-20)32(36)37)30(33(38)39)34(27)18-23-16-29-28(41-19-42-29)15-21(23)4-2/h7-11,13,15-17H,3-6,12,14,18-19H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | UKUDNNUJALQAMV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|