C24H18KN5OS — CID 52943338
potassium 5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate (PubChem CID 52943338) has the molecular formula C24H18KN5OS and a molecular weight of 463.61 g/mol. Its IUPAC name is potassium 5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate.
| Compound Name | potassium 5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 52943338 |
| Molecular Formula | C24H18KN5OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | potassium 5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate |
| SMILES | [K+].[S-]c1nnc(Cc2nc(-c3ccccc3)no2)n1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H19N5OS.K/c31-24-27-26-21(15-22-25-23(28-30-22)18-11-5-2-6-12-18)29(24)16-19-13-7-8-14-20(19)17-9-3-1-4-10-17;/h1-14H,15-16H2,(H,27,31);/q;+1/p-1 |
| InChIKey | HLUBNFYFYPTODF-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|