C31H28F2N4O2 — CID 52943413
N-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide (PubChem CID 52943413) has the molecular formula C31H28F2N4O2 and a molecular weight of 526.59 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide |
|---|---|
| PubChem CID | 52943413 |
| Molecular Formula | C31H28F2N4O2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-N-[[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-3'-yl]methyl]propanamide |
| SMILES | CC(C)(C)C(=O)N(Cc1cc(F)cc(F)c1)Cc1cnc2cc3c(cc2c1)C[C@@]1(C3)C(=O)Nc2ncccc21 |
| InChI | InChI=1S/C31H28F2N4O2/c1-30(2,3)29(39)37(16-18-8-23(32)12-24(33)9-18)17-19-7-20-10-21-13-31(14-22(21)11-26(20)35-15-19)25-5-4-6-34-27(25)36-28(31)38/h4-12,15H,13-14,16-17H2,1-3H3,(H,34,36,38)/t31-/m0/s1 |
| InChIKey | PQEJSMQCJQGFFY-HKBQPEDESA-N |
| XLogP | 5.47 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |