About 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride
5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride (PubChem CID 52943421) has the molecular formula C19H22ClN3O3
and a molecular weight of 375.86 g/mol. Its IUPAC name is 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride.
Molecular Properties
| Compound Name | 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride |
| PubChem CID | 52943421 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride |
| SMILES | COc1cc(-c2ncoc2-c2ccc(N(C)C)cc2)cc(N)c1OC.Cl |
| InChI | InChI=1S/C19H21N3O3.ClH/c1-22(2)14-7-5-12(6-8-14)18-17(21-11-25-18)13-9-15(20)19(24-4)16(10-13)23-3;/h5-11H,20H2,1-4H3;1H |
| InChIKey | GKMOVBYROZMEFD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride?
The IUPAC name of 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride (CID 52943421) is 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride.
What is the SMILES notation for 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride?
The canonical SMILES for 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride is COc1cc(-c2ncoc2-c2ccc(N(C)C)cc2)cc(N)c1OC.Cl.
What is the InChIKey of 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride?
The InChIKey is GKMOVBYROZMEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3.ClH/c1-22(2)14-7-5-12(6-8-14)18-17(21-11-25-18)13-9-15(20)19(24-4)16(10-13)23-3;/h5-11H,20H2,1-4H3;1H.
What are the key properties of 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride?
5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride has a molecular weight of 375.86 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-2,3-dimethoxyaniline;hydrochloride is sourced from PubChem (CID 52943421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).