C20H22FN5O3 — CID 52943501
N-[[(5S)-3-[4-[4-[(diaminomethylideneamino)methyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 52943501) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-[(diaminomethylideneamino)methyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[4-[(diaminomethylideneamino)methyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 52943501 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[[(5S)-3-[4-[4-[(diaminomethylideneamino)methyl]phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(CN=C(N)N)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H22FN5O3/c1-12(27)24-10-16-11-26(20(28)29-16)15-6-7-17(18(21)8-15)14-4-2-13(3-5-14)9-25-19(22)23/h2-8,16H,9-11H2,1H3,(H,24,27)(H4,22,23,25)/t16-/m0/s1 |
| InChIKey | PZRNNZUOTNIHDY-INIZCTEOSA-N |
| XLogP | 1.73 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|