About 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol
4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol (PubChem CID 52943526) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol |
| PubChem CID | 52943526 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol |
| SMILES | NCCC1(O)CC2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C12H21NO/c13-2-1-12(14)7-9-3-8-4-10(5-9)11(12)6-8/h8-11,14H,1-7,13H2 |
| InChIKey | IOSWNQSWIDISOG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol?
The IUPAC name of 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol (CID 52943526) is 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol.
What is the SMILES notation for 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol?
The canonical SMILES for 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol is NCCC1(O)CC2CC3CC(C2)C1C3.
What is the InChIKey of 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol?
The InChIKey is IOSWNQSWIDISOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c13-2-1-12(14)7-9-3-8-4-10(5-9)11(12)6-8/h8-11,14H,1-7,13H2.
What are the key properties of 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol?
4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol has a molecular weight of 195.31 g/mol, XLogP of 1.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)tricyclo[4.3.1.03,8]decan-4-ol is sourced from PubChem (CID 52943526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).