C32H48O11 — CID 52943584
[(3S,3aR,4S,6S,6aR,7S,8S,9bS)-4-butanoyloxy-3,3a,6-trihydroxy-3,6,9-trimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] octanoate (PubChem CID 52943584) has the molecular formula C32H48O11 and a molecular weight of 608.73 g/mol. Its IUPAC name is [(3S,3aR,4S,6S,6aR,7S,8S,9bS)-4-butanoyloxy-3,3a,6-trihydroxy-3,6,9-trimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] octanoate.
| Compound Name | [(3S,3aR,4S,6S,6aR,7S,8S,9bS)-4-butanoyloxy-3,3a,6-trihydroxy-3,6,9-trimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] octanoate |
|---|---|
| PubChem CID | 52943584 |
| Molecular Formula | C32H48O11 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | [(3S,3aR,4S,6S,6aR,7S,8S,9bS)-4-butanoyloxy-3,3a,6-trihydroxy-3,6,9-trimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] octanoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C(C)=C2[C@H]([C@@H]1OC(=O)CCCCCCC)[C@@](C)(O)C[C@H](OC(=O)CCC)[C@@]1(O)[C@H]2OC(=O)[C@@]1(C)O |
| InChI | InChI=1S/C32H48O11/c1-8-11-12-13-14-16-22(34)41-26-24-23(19(5)25(26)42-28(35)18(4)10-3)27-32(39,31(7,38)29(36)43-27)20(17-30(24,6)37)40-21(33)15-9-2/h10,20,24-27,37-39H,8-9,11-17H2,1-7H3/b18-10-/t20-,24+,25-,26-,27-,30-,31+,32+/m0/s1 |
| InChIKey | JZLDSLKESQBASU-MMHRDHQVSA-N |
| XLogP | 3.36 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|