C23H28N2O2 — CID 52943612
2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-methyl-N-phenylacetamide (PubChem CID 52943612) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 52943612 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-methyl-N-phenylacetamide |
| SMILES | C[C@H]1CN(CC(=O)N(C)c2ccccc2)[C@@H]2Cc3ccc(O)cc3[C@]1(C)C2 |
| InChI | InChI=1S/C23H28N2O2/c1-16-14-25(15-22(27)24(3)18-7-5-4-6-8-18)19-11-17-9-10-20(26)12-21(17)23(16,2)13-19/h4-10,12,16,19,26H,11,13-15H2,1-3H3/t16-,19+,23+/m0/s1 |
| InChIKey | JTGRNPYKTUVLFU-XKDCRVNJSA-N |
| XLogP | 3.58 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |