C19H17Cl2N3O2 — CID 52943695
1-[(2,4-dichlorophenyl)methyl]-5-(2-phenylethylamino)pyrimidine-2,4-dione (PubChem CID 52943695) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-5-(2-phenylethylamino)pyrimidine-2,4-dione.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-5-(2-phenylethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 52943695 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-5-(2-phenylethylamino)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(Cl)cc2Cl)cc1NCCc1ccccc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c20-15-7-6-14(16(21)10-15)11-24-12-17(18(25)23-19(24)26)22-9-8-13-4-2-1-3-5-13/h1-7,10,12,22H,8-9,11H2,(H,23,25,26) |
| InChIKey | DHMWWVKIHXIDBM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |