C15H11Cl2F3O3S — CID 52943755
2-[4-(2,4-dichlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 52943755) has the molecular formula C15H11Cl2F3O3S and a molecular weight of 399.22 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-(2,4-dichlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 52943755 |
| Molecular Formula | C15H11Cl2F3O3S |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(S(=O)(=O)c2ccc(Cl)cc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H11Cl2F3O3S/c1-14(21,15(18,19)20)9-2-5-11(6-3-9)24(22,23)13-7-4-10(16)8-12(13)17/h2-8,21H,1H3 |
| InChIKey | LUUQOLRTSMOAEH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |