About 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine
4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine (PubChem CID 52943875) has the molecular formula C18H15N3O2
and a molecular weight of 305.34 g/mol. Its IUPAC name is 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 52943875 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine |
| SMILES | COc1ccc(Cn2ccc3c(-c4ccco4)ncnc32)cc1 |
| InChI | InChI=1S/C18H15N3O2/c1-22-14-6-4-13(5-7-14)11-21-9-8-15-17(16-3-2-10-23-16)19-12-20-18(15)21/h2-10,12H,11H2,1H3 |
| InChIKey | FBVUOZWUDYOYSF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine (CID 52943875) is 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine is COc1ccc(Cn2ccc3c(-c4ccco4)ncnc32)cc1.
What is the InChIKey of 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine?
The InChIKey is FBVUOZWUDYOYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2/c1-22-14-6-4-13(5-7-14)11-21-9-8-15-17(16-3-2-10-23-16)19-12-20-18(15)21/h2-10,12H,11H2,1H3.
What are the key properties of 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine?
4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine has a molecular weight of 305.34 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-7-[(4-methoxyphenyl)methyl]pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 52943875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).