C19H29F3N4O6 — CID 52943908
(2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[[(Z)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 52943908) has the molecular formula C19H29F3N4O6 and a molecular weight of 466.46 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[[(Z)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[[(Z)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 52943908 |
| Molecular Formula | C19H29F3N4O6 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[[(Z)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@@H](CCCCNC(=O)/C=C(/C)C(F)(F)F)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H29F3N4O6/c1-10(19(20,21)22)9-15(28)23-8-6-5-7-14(17(30)25-12(3)18(31)32)26-16(29)11(2)24-13(4)27/h9,11-12,14H,5-8H2,1-4H3,(H,23,28)(H,24,27)(H,25,30)(H,26,29)(H,31,32)/b10-9-/t11-,12-,14-/m0/s1 |
| InChIKey | NMNUAFRFKXBTRK-RYCWWULWSA-N |
| XLogP | 0.38 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|